| Identification | |
| Name: | Benzene,1-methyl-2,4,5-trinitro- |
| Synonyms: | Toluene,2,4,5-trinitro- (8CI); 1-Methyl-2,4,5-trinitrobenzene; 2,4,5-Trinitrotoluene |
| CAS: | 610-25-3 |
| EINECS: | 210-214-8 |
| Molecular Formula: | C7H5 N3 O6 |
| Molecular Weight: | 227.15 |
| InChI: | InChI=1/C7H5N3O6/c1-4-2-6(9(13)14)7(10(15)16)3-5(4)8(11)12/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 218.8°C |
| Boiling Point: | 413.1°C at 760 mmHg |
| Density: | 1.608g/cm3 |
| Refractive index: | 1.637 |
| Specification: |
2,4,5-Trinitrotoluene , its cas register number is 610-25-3. It also can be called Benzene, 1-methyl-2,4,5-trinitro- ; 2,4,5-trinitro-toluene ; and Toluene, 2,4,5-trinitro- . |
| Flash Point: | 218.8°C |
| Safety Data | |
 |
|
