| Identification | |
| Name: | Benzoicacid, 2,4-dinitro- |
| Synonyms: | 1-Carboxy-2,4-dinitrobenzene;2,4-Dinitrobenzoic acid;NSC 243713; |
| CAS: | 610-30-0 |
| EINECS: | 210-219-5 |
| Molecular Formula: | C7H4N2O6 |
| Molecular Weight: | 212.11646 |
| InChI: | InChI=1S/C7H4N2O6/c10-7(11)5-2-1-4(8(12)13)3-6(5)9(14)15/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.688 g/cm3 |
| Water Solubility: | dioxane: 50 mg/mL, clear |
| Solubility: | dioxane: 50 mg/mL, clear |
| Specification: | pale yellow crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
