| Identification | |
| Name: | 1-Anthracenamine |
| Synonyms: | 1-Anthramine(6CI,7CI,8CI); 1-Aminoanthracene; 1-Anthracenylamine; 1-Anthracylamine;1-Anthrylamine; NSC 60017; a-Aminoanthracene |
| CAS: | 610-49-1 |
| EINECS: | 210-225-8 |
| Molecular Formula: | C14H11 N |
| Molecular Weight: | 193.26 |
| InChI: | InChI=1/C14H11N/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H,15H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 114-118 °C(lit.) |
| Flash Point: | 224.4°C |
| Boiling Point: | 408.2°C at 760 mmHg |
| Density: | 1.208g/cm3 |
| Refractive index: | 1.765 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 224.4°C |
| Safety Data | |
 |
|
