| Identification | |
| Name: | Phenol,4-chloro-3-nitro- |
| Synonyms: | 2-Chloro-5-hydroxynitrobenzene;3-Nitro-4-chlorophenol; 4-Chloro-3-nitrophenol; NSC 211001 |
| CAS: | 610-78-6 |
| Molecular Formula: | C6H4 Cl N O3 |
| Molecular Weight: | 173.55 |
| InChI: | InChI=1/C6H4ClNO3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 140.5 ºC |
| Boiling Point: | 308.8 ºC at 760 mmHg |
| Density: | 1.554 g/cmºC |
| Refractive index: | 1.626 |
| Solubility: | Slightly soluble |
| Appearance: | brown |
| Specification: |
Move victim to fresh air. Apply artificial respiration if victim is not breathing. Do not use mouth-to-mouth method if victim ingested or inhaled the substance; induce artificial respiration with the aid of a pocket mask equipped with a one-way valve or other proper respiratory medical device. Administer oxygen if breathing is difficult. |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Flash Point: | 140.5 ºC |
| Color: | brown |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
