| Identification | |
| Name: | 1,4-Benzenedicarboxylicacid, 2,5-dihydroxy- |
| Synonyms: | Terephthalicacid, 2,5-dihydroxy- (6CI,7CI,8CI);2,5-Dihydroxy-1,4-benzenedicarboxylic acid;2,5-Dihydroxyterephthalic acid;Hydroquinone-2,5-dicarboxylic acid;NSC 407960; |
| CAS: | 610-92-4 |
| EINECS: | 210-239-4 |
| Molecular Formula: | C8H6O6 |
| Molecular Weight: | 198.13 |
| InChI: | InChI=1/C8H6O6/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 oC |
| Density: | 1.779g/cm3 |
| Refractive index: | 1.717 |
| Specification: |
? 1,4-Benzenedicarboxylicacid, 2,5-dihydroxy- , its cas register number is 610-92-4. It also can be called?AI3-17877?; 2,5-Dihydroxyterephthalic acid .?1,4-Benzenedicarboxylicacid, 2,5-dihydroxy- (CAS NO.610-92-4) is orritating to eyes, respiratory system and skin. So you should wear?suitable gloves and eye/face protection. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
