| Identification | |
| Name: | Benzoicacid, 2-chloro-, methyl ester |
| Synonyms: | Benzoicacid, o-chloro-, methyl ester (6CI,7CI,8CI);2-Chlorobenzoic acid methyl ester;Methyl 2-chlorobenzoate;Methyl o-chlorobenzoate;NSC 7320; |
| CAS: | 610-96-8 |
| EINECS: | 210-242-0 |
| Molecular Formula: | C8H7ClO2 |
| Molecular Weight: | 170.59298 |
| InChI: | InChI=1S/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 233-235 °C |
| Density: | 1.191 |
| Refractive index: | 1.536 |
| Water Solubility: | 567 mg/L at 25 °C in water |
| Solubility: | 567 mg/L at 25 °C in water |
| Appearance: | White to light yellow crystal powder |
| Specification: | White to light yellow crystal powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
