Identification |
Name: | 5H-Dibenzo[b,e][1,4]diazepine,8-chloro-11-(1-piperazinyl)- |
Synonyms: | ACP 104;Demethylclozapine; Desmethylclozapine; N-Demethylclozapine;N-Desmethylclozapine; Norclozapine |
CAS: | 6104-71-8 |
Molecular Formula: | C17H17 Cl N4 |
Molecular Weight: |
312.80 |
InChI: | InChI=1/C17H17ClN4/c18-12-5-6-15-16(11-12)21-17(22-9-7-19-8-10-22)13-3-1-2-4-14(13)20-15/h1-6,11,19,21H,7-10H2 |
Molecular Structure: |
|
Properties |
Transport: | 3249 |
Flash Point: | 250.2°C |
Boiling Point: | 490.1°C at 760 mmHg |
Density: | 1.38g/cm3 |
Refractive index: | 1.709 |
Specification: | Yellow Crystalline Solid usageEng:A major metabolite of Clozapine. A potent and selective 5-HT2C serotonin receptor antogonist. Safety Statements:22-36-45 22:Do not breathe dust 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Packinggroup: | III |
Biological Activity: | A major metabolite of clozapine; a potent and selective 5-HT 2C serotonin receptor antagonist. |
Flash Point: | 250.2°C |
Storage Temperature: | Store at RT |
Usage: | A major metabolite of Clozapine. A potent and selective 5-HT2C serotonin receptor antogonist. |
Safety Data |
|
|