Identification |
Name: | L-Tyrosine,O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-, sodium salt, hydrate (1:1:5) |
Synonyms: | Alanine,3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-, monosodium salt,pentahydrate, L- (8CI); L-Tyrosine, O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-,monosodium salt, pentahydrate (9CI); 3',3,5',5-Tetraiodo-L-thyronine sodiumsalt pentahydrate; Sodium levothyroxine pentahydrate |
CAS: | 6106-07-6 |
EINECS: | 200-221-4 |
Molecular Formula: | C15H11 I4 N O4 . 5 H2 O . Na |
Molecular Weight: | 888.95 |
InChI: | InChI=1S/C15H11I4NO4.Na.5H2O/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;;;;;;/h1-2,4-5,12,21H,3,20H2,(H,22,23);;5*1H2/q;+1;;;;;/p-1/t12-;;;;;;/m0....../s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 207-210 (dec.)(lit.)
|
Density: | 2.381 |
Specification: | Safety Statements:22-24/25-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
|
|
|