| Identification | |
| Name: | Carbonic acid, sodiumsalt (2:3), dihydrate (8CI,9CI) |
| Synonyms: | Snowfine;Sodium carbonate (Na3(HCO3)(CO3)) dihydrate; Sodium carbonate (Na3H(CO3)2)dihydrate; Sodium sesquicarbonate (Na2CO3.NaHCO3.2H2O); Sodium sesquicarbonatedihydrate |
| CAS: | 6106-20-3 |
| Molecular Formula: | CH2 O3 . H2 O . 3/2 Na |
| Molecular Weight: | 190 |
| InChI: | InChI=1/CH2O3.Na.2H2O/c2-1(3)4;;;/h(H2,2,3,4);;2*1H2/q;+1;;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
