| Identification | |
| Name: | 4-Piperidinemethanol,4-(phenylamino)-1-(phenylmethyl)- |
| Synonyms: | 1-Benzyl-4-phenylamino-4-(hydroxymethyl)piperidine;4-Anilino-1-benzyl-4-piperidinemethanol; [1-Benzyl-4-(phenylamino)piperidin-4-yl]methanol |
| CAS: | 61086-04-2 |
| EINECS: | 262-595-5 |
| Molecular Formula: | C19H24 N2 O |
| Molecular Weight: | 296.40666 |
| InChI: | InChI=1/C19H24N2O/c22-16-19(20-18-9-5-2-6-10-18)11-13-21(14-12-19)15-17-7-3-1-4-8-17/h1-10,20,22H,11-16H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 228.8°C |
| Boiling Point: | 454.6°C at 760 mmHg |
| Density: | 1.149g/cm3 |
| Refractive index: | 1.625 |
| Specification: | Off-White to Pale Brown Solid usageEng:An intermediate in the preparation of Alfentanil and Sufentanil Citrate |
| Flash Point: | 228.8°C |
| Storage Temperature: | Refrigerator |
| Usage: | An intermediate in the preparation of Alfentanil and Sufentanil Citrate |
| Safety Data | |
 |
|
