| Identification | |
| Name: | 9H-Carbazol-3-amine,9-ethyl-, hydrochloride (1:1) |
| Synonyms: | 9H-Carbazol-3-amine,9-ethyl-, monohydrochloride (9CI); Carbazole, 3-amino-9-ethyl-, hydrochloride(7CI,8CI); 3-Amino-9-ethylcarbazole monohydrochloride |
| CAS: | 6109-97-3 |
| EINECS: | 228-072-0 |
| Molecular Formula: | C14H14 N2 . Cl H |
| Molecular Weight: | 246.76 |
| InChI: | InChI=1/C14H14N2.ClH/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16;/h3-9H,2,15H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 127 deg C |
| Flash Point: | 208.4°C |
| Boiling Point: | 420.9°C at 760 mmHg |
| Specification: |
3-Amino-9-ethylcarbazole-hydrochloride (CAS NO.6109-97-3) is also called 3-Amino-9-ethylcarbazole monohydrochloride ; CCRIS 5885 ; NCI-C03043 ; NSC 7426 ; (9-Ethyl-9H-carbazol-3-yl)ammonium chloride ; 9H-Carbazol-3-amine, 9-ethyl-, monohydrochloride (1:1) ; Carbazole, 3-amino-9-ethyl-, hydrochloride . 3-Amino-9-ethylcarbazole-hydrochloride (CAS NO.6109-97-3) is high toxic. It is flammable. It will produce toxic nitrogen oxide and hydrogen chloride fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Report: |
NCI Carcinogenesis Bioassay Completed; Results Positive: mouse, rat NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-93 ,1978. |
| Flash Point: | 208.4°C |
| Color: | Crystalline compound |
| Safety Data | |
 |
|
