| Identification |
| Name: | Cyclopentanecarboxylicacid, 2-oxo-, ethyl ester |
| Synonyms: | 1-Oxocyclopentane-2-carboxylic acid ethyl ester;2-(Ethoxycarbonyl)-1-cyclopentanone;2-(Ethoxycarbonyl)cyclopentanone;2-Carbethoxy-1-cyclopentanone;2-Carbethoxycyclopentanone;2-Cyclopentanonecarboxylic acid ethyl ester;2-Oxocyclopentanecarboxylic acidethyl ester;Ethyl 1-oxocyclopentane-2-carboxylate;Ethyl 2-cyclopentanone-1-carboxylate;Ethyl 2-cyclopentanonecarboxylate;Ethyl2-oxocyclopentanoate;NSC 22055;NSC 5658;a-(Carboethoxy)cyclopentanone; |
| CAS: | 611-10-9 |
| EINECS: | 210-253-0 |
| Molecular Formula: | C8H12O3 |
| Molecular Weight: | 156.18 |
| InChI: | InChI=1/C8H12O3/c1-2-11-8(10)6-4-3-5-7(6)9/h6H,2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.054 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.45-1.454 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear colourless to pale yellow liquid |
| HS Code: | 29183000 |
| Safety Data |
| |
 |
