| Identification | |
| Name: | 2-Cyanophenol |
| Synonyms: | 2-Hydroxybenzonitrile= 2-Cyanophenol; Salicylonitrile; 2-Hydroxybenzonitrile,(2-Cyanophenol); 2-Hydroxybenzonitrile; 2-Hydroxy-benzonitril |
| CAS: | 611-20-1 |
| EINECS: | 210-259-3 |
| Molecular Formula: | C7H5NO |
| Molecular Weight: | 119.12 |
| InChI: | InChI=1/C7H5NO/c8-5-6-3-1-2-4-7(6)9/h1-4,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.1052 g/cm3 (99.6 C) |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.5372 (100 C) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | off-white to light brown powder |
| Specification: |
???2-Cyanophenol (CAS No.611-20-1), it also can be called 2-Hydroxybenzonitrile ; Benzonitrile, o-hydroxy- ; Salicylnitrile ; o-Cyanophenol ; o-Hydroxybenzonitrile . It is white to light yellow crystal powder. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
