Identification |
Name: | 2-Amino-6,7-dimethyl-4-hydroxypteridine hydrate |
Synonyms: | 2-Amino-6,7-dimethyl-4-hydroxypteridine; 2-Amino-6,7-dimethyl-4-pteridinol |
CAS: | 611-55-2 |
EINECS: | 210-270-3 |
Molecular Formula: | C8H9N5O |
Molecular Weight: | 191.193 |
InChI: | InChI=1/C8H9N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h1-2H3,(H3,9,11,12,13,14) |
Molecular Structure: |
|
Properties |
Flash Point: | 210.1°C |
Boiling Point: | 423.9°C at 760 mmHg |
Density: | 1.65g/cm3 |
Refractive index: | 1.79 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 210.1°C |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|