| Identification | |
| Name: | Paraxanthine |
| Synonyms: | Paraxanthine(6CI,7CI,8CI);1,7-Dimethylxanthine;NSC 400018;1H-Purine-2,6-dione,3,7-dihydro-1,7-dimethyl-; |
| CAS: | 611-59-6 |
| EINECS: | 210-271-9 |
| Molecular Formula: | C7H8N4O2 |
| Molecular Weight: | 180.16402 |
| InChI: | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.6 g/cm3 |
| Stability: | Store tightly sealed at RT |
| Refractive index: | 1.737 |
| Water Solubility: | 0.6 mg/mL in ethanol |
| Solubility: | 0.6 mg/mL in ethanol |
| Appearance: | off-white to pale yellow solid |
| Specification: |
Paraxanthine (CAS NO.611-59-6) is also named as 1,7-Dimethylxanthine ; 3,7-Dihydro-1,7-dimethyl-1H-purine-2,6-dione ; 5-26-13-00554 (Beilstein Handbook Reference) ; BRN 0197907 ; NSC 400018 ; Xanthine, 1,7-dimethyl- ; p-Xanthine ; 1H-Purine-2,6-dione, 3,7-dihydro-1,7-dimethyl- (9CI) . Paraxanthine (CAS NO.611-59-6) is off-white to pale yellow solid. It is a dimethyl derivative of xanthine, structurally related to caffeine. Like caffeine, paraxanthine is a psychoactive central nervous system (CNS) stimulant. |
| Color: | white |
| Usage: |
Paraxanthine (CAS NO.611-59-6) is used as an adenosine receptor ligand and a major metabolite of caffeine. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
