| Identification | |
| Name: | Benzeneaceticacid, a-hydroxy-, (aR)- |
| Synonyms: | Benzeneaceticacid, a-hydroxy-, (R)-;Mandelic acid, D-(8CI);(-)-(R)-Mandelic acid;(-)-D-Mandelic acid;(-)-Mandelic acid;(-)-a-Hydroxyphenylacetic acid;(R)-(-)-Hydroxyphenylaceticacid;(R)-(-)-Mandelic acid;(R)-2-Hydroxy-2-(phenyl)ethanoic acid;(R)-2-Hydroxy-2-phenylacetic acid;(R)-Hydroxy(phenyl)acetic acid;(R)-Mandelicacid;(R)-Mandelic acid;(R)-a-Hydroxybenzeneaceticacid;(R)-a-Hydroxyphenylacetic acid;D(-)-Mandelic acid;D-2-Phenylglycolic acid;D-Mandelic acid;R-(-)-Mandelic acid; |
| CAS: | 611-71-2 |
| EINECS: | 210-276-6 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.14732 |
| InChI: | InChI=1S/C8H8O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7,9H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs in |
| Density: | 1.321 g/cm3 |
| Stability: | Stable, but light sensitive. Combustible. Incompatible with strong bases, strong oxidizing agents. |
| Alpha: | -150 o (C=2.5, H2O) |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | White crystals |
| Specification: | white to light yellow crystal powde usageEng:Antiseptic (urinary). Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29181980 |
| Storage Temperature: | Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. |
| Sensitive: | Light Sensitive |
| Usage: | Antiseptic (urinary). |
| Safety Data | |
 |
|
