| Identification | |
| Name: | Urea,N,N'-dimethyl-N,N'-diphenyl- |
| Synonyms: | Carbanilide,N,N'-dimethyl- (7CI,8CI);Carbanilide, a,b-dimethyl- (3CI);1,3-Dimethyl-1,3-diphenylurea;Centralite II;Dimethylcarbanilide;Methyl centralite;N,N'-Dimethyl-N,N'-diphenylurea;N,N'-Dimethylcarbanilide;NSC 59781; |
| CAS: | 611-92-7 |
| EINECS: | 210-283-4 |
| Molecular Formula: | C15H16N2O |
| Molecular Weight: | 240.30 |
| InChI: | InChI=1/C15H16N2O/c1-16(13-9-5-3-6-10-13)15(18)17(2)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 100kgs |
| Melting Point: | 120 - 122 C |
| Density: | 1.161 g/cm3 |
| Refractive index: | 1.639 |
| Water Solubility: | soluble in alcohol, ether and benzene, insoluble in water. |
| Solubility: | Insolube (Soluble in EtOH, Benzene, Nitroglycerine) |
| Appearance: | White to grey crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols | |
 |
|
