| Identification | |
| Name: | L-Leucine, N-formyl- |
| Synonyms: | Leucine,N-formyl-, L- (8CI);(S)-(+)-2-Formamido-4-methylpentanoic acid;N-Formyl-L-leucine;N-Formyl-S-leucine;N-Formylleucine;NSC 334321; |
| CAS: | 6113-61-7 |
| EINECS: | 228-080-4 |
| Molecular Formula: | C7H13NO3 |
| Molecular Weight: | 159.18302 |
| InChI: | InChI=1S/C7H13NO3/c1-5(2)3-6(7(10)11)8-4-9/h4-6H,3H2,1-2H3,(H,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.093 g/cm3 |
| Refractive index: | -39.5 ° (C=1, H2O) |
| Water Solubility: | Soluble in hot water at approx. 0.5:20 (w/v) |
| Solubility: | Soluble in hot water at approx. 0.5:20 (w/v) |
| Appearance: | white powder |
| Specification: |
The CAS register number of N-Formyl-L-leucine is 6113-61-7. It also can be called as L-Leucine, N-formyl- and the IUPAC name about this chemical is 2-formamido-4-methylpentanoic acid. It belongs to the following product categories, such as Aminoacids derivatives, Amino Acids 13C, 2H, 15N, Amino Acids & Derivatives, Chiral Reagents, A - H, Amino Acids, Modified Amino Acids and so on. This chemical can be used as a synthetic substrate of the lipase inhibitor lipstatin. Physical properties about N-Formyl-L-leucine are: (1)ACD/LogP: -0.67; (2)ACD/LogD (pH 5.5): -1; (3)ACD/LogD (pH 7.4): -3; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 66.4Å2; (12)Index of Refraction: 1.458; (13)Molar Refractivity: 39.743 cm3; (14)Molar Volume: 145.596 cm3; (15)Polarizability: 15.755x10-24cm3; (16)Surface Tension: 39.087 dyne/cm; (17)Enthalpy of Vaporization: 66.609 kJ/mol; (18)Boiling Point: 360.649 °C at 760 mmHg. You can still convert the following datas into molecular structure: |
| Storage Temperature: | −20°C |
| Color: | white |
| Safety Data | |
 |
|
