| Identification | |
| Name: | Benzene,2-bromo-1-(bromomethyl)-4-fluoro- |
| Synonyms: | 2-Bromo-1-bromomethyl-4-fluorobenzene;2-Bromo-4-fluorobenzyl bromide; |
| CAS: | 61150-57-0 |
| Molecular Formula: | C7H5Br2F |
| Molecular Weight: | 267.92 |
| InChI: | InChI=1/C7H5Br2F/c8-4-5-1-2-6(10)3-7(5)9/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107.4°C |
| Boiling Point: | 253.975°C at 760 mmHg |
| Density: | 1.923g/cm3 |
| Refractive index: | 1.583 |
| Appearance: | white crystal powder |
| Specification: |
2-Bromo-1-(bromomethyl)-4-fluorobenzene with cas registry number of 61150-57-0 is also known as 2-Bromo-1-(bromomethyl)-4-fluorobenzene ; A,2-Dibromo-4-fluorotoluene ; Benzene, 2-bromo-1-(bromomethyl)-4-fluoro- ; 2-Bromo-4- fluorobenzyl bromide ; 2-Bromo-4-fluorobenzyl bromide ; 2-Bromo-4-fluorobenzylBromide . It is a organic halogen compound which should be stored in a cool, dry place and kept container closed when not in use. It would emit acrid smoke and irritating fumes when heated to decomposition . |
| Flash Point: | 107.4°C |
| Safety Data | |
 |
|
