Identification |
Name: | Quinine hydrochloride dihydrate |
Synonyms: | Cinchonan-9-ol,6'-methoxy-, monohydrochloride, dihydrate, (8a,9R)- (9CI);(R)-(5-Ethenyl-1-azabicyclo[2.2.2]octan-7-yl)-(6-methoxyquinolin-4-yl)methanol dihydrate hydrochloride;Cinchonan-9-ol,6'-methoxy-, hydrochloride, hydrate (1:1:2), (8a,9R)-; |
CAS: | 6119-47-7 |
EINECS: | 231-437-7 |
Molecular Formula: | C20H29ClN2O4 |
Molecular Weight: | 396.91 |
InChI: | InChI=1/C20H24N2O2.ClH.2H2O/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1H;2*1H2/t13?,14?,19?,20-;;;/m1.../s1 |
Molecular Structure: |
|
Properties |
Transport: | 1544 |
Refractive index: | -250 ° (C=2, EtOH) |
Appearance: | white to light yellow crystal powder |
Specification: |
Quinine hydrochloride dihydrate , its cas register number is 6119-47-7. It also can be called (R)-(5-Ethenyl-1-azabicyclo[2.2.2]octan-7-yl)-(6-methoxyquinolin-4-yl)methanol dihydrate hydrochloride ; Quinine hydrochloride [NF XI:JAN] ; Quinine HCl ; Quinine hydrochloride ; Quinine monohydrochloride .It is a white to light yellow crystal powder.
|
HS Code: | 29392000 |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|