Identification |
Name: | 2-Nitrobenzyl chloride |
Synonyms: | alpha-Chloro-2-nitrotoluene; Nitrobenzylchloride; 98%; 2-Nitrobenzyl chloride, (a-Chloro-2-nitrotoluene) |
CAS: | 612-23-7 |
EINECS: | 210-300-5 |
Molecular Formula: | C7H6ClNO2 |
Molecular Weight: | 171.58104 |
InChI: | InChI=1S/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3261 |
Density: | 1.556 |
Stability: | Stable. Incompatible with bases, moisture, acohols, oxidizing agents, amines. Corrodes steel. |
Refractive index: | 1.574 |
Water Solubility: | Stability Stable. Incompatible with bases, moisture, acohols, oxidizing agents, amines.Corrodes steel.Toxicology Corrosive - causes burns. Very destructive of mucous membranes.Harmful if swallowed. |
Solubility: | |
Appearance: | liquid |
Specification: |
2-Nitrobenzyl Chloride (CAS NO.612-23-7) is a pale yellow crystals.It is insoluble in water and is thermally unstable. A halogenated aromatic nitro compound. Aromatic nitro compounds range from slight to strong oxidizing agents. If mixed with reducing agents, including hydrides, sulfides and nitrides, they may begin a vigorous reaction that culminates in a detonation. The aromatic nitro compounds may explode in the presence of a base such as sodium hydroxide or potassium hydroxide even in the presence of water or organic solvents. The explosive tendencies of aromatic nitro compounds are increased by the presence of multiple nitro groups. It is toxic an lachrymator. It can causes irritation on contact. Hazardous decomposition products. Mutagen. And it is combustible.
|
Packinggroup: | II |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |