| Identification | |
| Name: | Benzenamine,N-ethyl-N-nitroso- |
| Synonyms: | Aniline,N-ethyl-N-nitroso- (6CI,7CI,8CI); N-Ethyl-N-nitrosoaniline;N-Ethyl-N-phenylnitrosamine; N-Nitroso-N-ethylaniline; N-Nitrosoethylphenylamine;NSC 405070 |
| CAS: | 612-64-6 |
| Molecular Formula: | C8H10 N2 O |
| Molecular Weight: | 150.1778 |
| InChI: | InChI=1S/C8H10N2O/c1-2-10(9-11)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 114.8°C |
| Boiling Point: | 130 C |
| Density: | 1.03g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.528 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | yellow liquid |
| Specification: |
N-Nitroso-N-ethyl aniline ,its cas register number is 612-64-6. It also can be called Benzenamine, N-ethyl-N-nitroso- ; N-Ethyl-N-nitrosobenzenamine ;and Aniline, N-ethyl-N-nitroso- . It is a nitrated amine. When heated, vapors may form explosive mixtures with air: indoors, outdoors and sewers explosion hazards. |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Flash Point: | 114.8°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
