| Identification | |
| Name: | 4-Pentylcyclohexanone |
| Synonyms: | 4-Pentyl cyclohexanone;4-Amylcyclohexanone;4-n-Amylcyclohexanone;4-n-Pentylcyclohexanone;Cyclohexanone, 4-pentyl-; |
| CAS: | 61203-83-6 |
| EINECS: | 406-670-4 |
| Molecular Formula: | C11H20O |
| Molecular Weight: | 168.28 |
| InChI: | InChI=1/C11H20O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h10H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3082 |
| Flash Point: | 89.9 ºC |
| Boiling Point: | 237.1 ºC at 760 mmHg |
| Density: | 0.885 g/cm3 |
| Refractive index: | 1.449 |
| Specification: |
4-Pentylcyclohexanone (CAS NO.61203-83-6), its Synonyms are 4-N-Pentylcyclohexanone ; 4-N-Amylcyclohexanone ; 4-N-Pentylcyclohexanone, 98+% ; 4-N-Amylcyclohexanone, 98+% ; 4-Pentylcyclohexanon . |
| Flash Point: | 89.9 ºC |
| Usage: |
4-Pentylcyclohexanone (CAS NO.61203-83-6) is used as an intermediate of liquid crystal monomer and also used in pharmaceutical synthesis, etc. |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
