| Identification | |
| Name: | 2(5H)-Furanone,4-methyl- |
| Synonyms: | Crotonicacid, 4-hydroxy-3-methyl-, g-lactone (6CI,7CI);2,5-Dihydro-4-methyl-2-furanone;3-Methylbut-2-en-4-olide;3-Methylbut-2-enolide;4-Hydroxy-3-methyl-2-butenoicacid lactone;4-Hydroxy-3-methyl-2-butenoic acid g-lactone;4-Methyl-2(5H)-furanone;4-Methyl-5H-furan-2-one; |
| CAS: | 6124-79-4 |
| Molecular Formula: | C5H6O2 |
| Molecular Weight: | 98.1 |
| InChI: | InChI=1/C5H6O2/c1-4-2-5(6)7-3-4/h2H,3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.12 g/cm3 |
| Refractive index: | 1.471 |
| Specification: |
The cas register number of 4-Methyl-2(5H)-furanone is 6124-79-4. It also can be called as 2(5H)-Furanone, 4-methyl- and the Systematic name about this chemical is 3-methyl-2H-furan-5-one. Physical properties about 4-Methyl-2(5H)-furanone are: (1)ACD/LogP: -0.25; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.25; (4)ACD/LogD (pH 7.4): -0.25; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 17.51; (8)ACD/KOC (pH 7.4): 17.51; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 26.3Å2; (13)Index of Refraction: 1.471; (14)Molar Refractivity: 24.49 cm3; (15)Molar Volume: 87.5 cm3; (16)Surface Tension: 33.1 dyne/cm; (17)Density: 1.12 g/cm3; (18)Flash Point: 83.3 °C; (19)Enthalpy of Vaporization: 45.89 kJ/mol; (20)Boiling Point: 222.4 °C at 760 mmHg; (21)Vapour Pressure: 0.102 mmHg at 25°C. Uses of 4-Methyl-2(5H)-furanone: It reacts to get 4-methyl-dihydro-furan-2-one. This reaction needs solvent ethanol. The reaction time is 7 days. The yield is 80 %. When you are using this chemical, please be cautious about it as the following: People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
