| Identification | |
| Name: | 2-Aminoanthracene |
| Synonyms: | 2-anthramine practical grade*crystalline; 2-anthrylamine ; 2-Anthramine; 2-Anthranamine |
| CAS: | 613-13-8 |
| EINECS: | 210-330-9 |
| Molecular Formula: | C14H11N |
| Molecular Weight: | 193.24384 |
| InChI: | InChI=1S/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 229°C |
| Boiling Point: | Vapour density: |
| Density: | 1.208g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.765 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Causes photosensitivity. Exposure to light can lead to allergic reaction.Skin, eye and respiratory irritant. |
| Solubility: |
|
| Appearance: | yellow powder |
| Specification: | yellow powder Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 229°C |
| Color: | Yellow leaflets from alcohol |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
