| Identification | |
| Name: | Benzamide,N-methyl- |
| Synonyms: | N-Methylbenzamide;N-Methylbenzenamide;N-Methylbenzenecarboxamide;NSC 42944;CCRIS 4670;NSC 42944;ZINC00336927;BRN 1209880; |
| CAS: | 613-93-4 |
| EINECS: | 210-362-3 |
| Molecular Formula: | C8H9NO |
| Molecular Weight: | 135.1632 |
| InChI: | InChI=1S/C8H9NO/c1-9-8(10)7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.041 g/cm3 |
| Refractive index: | 1.526 |
| Appearance: | white crystals or crystalline powder |
| Specification: |
N-Methylbenzenamide (CAS NO.613-93-4) is a white crystals or crystalline powder.It insoluble in water. And it is an amide. Amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
