| Identification | |
| Name: | Benzoylhydrazine |
| Synonyms: | Benzhydrazide, (Benzoic acid hydrazide; Benzoyl-hydrazine); Benzoic acid hydrazide; benzoic hydrazide; benzohydrazide; Linoleic Acid; 9,12-Octadecadienoic acid; Benzhydrazide |
| CAS: | 613-94-5 |
| EINECS: | 210-363-9 |
| Molecular Formula: | C7H8N2O |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.164 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.577 |
| Solubility: | soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: | WHITE TO BEIGE NEEDLE-LIKE CRYSTALS OR POWDER Safety Statements:26-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| HS Code: | 29280090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Plates from water |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
