Identification |
Name: | 4-Piperidinamine,4-(methoxymethyl)-N-phenyl-1-(phenylmethyl)- |
Synonyms: | 1-Benzyl-4-(methoxymethyl)-N-phenylpiperidin-4-amine;1-Benzyl-4-phenylamino-4-(methoxymethyl)piperidine |
CAS: | 61380-02-7 |
EINECS: | 262-746-5 |
Molecular Formula: | C20H26 N2 O |
Molecular Weight: | 310.43324 |
InChI: | InChI=1/C20H26N2O/c1-23-17-20(21-19-10-6-3-7-11-19)12-14-22(15-13-20)16-18-8-4-2-5-9-18/h2-11,21H,12-17H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 215.2°C |
Boiling Point: | 432.3°C at 760 mmHg |
Density: | 1.096g/cm3 |
Refractive index: | 1.593 |
Flash Point: | 215.2°C |
Usage: | An intermediate in the preparation of Alfentanil and Sufentanil Citrate |
Safety Data |
|
 |