| Identification | |
| Name: | Benzenepropanoic acid, b-oxo- |
| Synonyms: | Aceticacid, benzoyl- (6CI,7CI,8CI); 3-Oxo-3-phenylpropanoic acid;3-Oxo-3-phenylpropionic acid; Benzoylacetic acid; Hydrocinnamic acid, b-oxo-; NSC 97769; b-Oxobenzenepropanoic acid |
| CAS: | 614-20-0 |
| EINECS: | 204-556-7 |
| Molecular Formula: | C9H8 O3 |
| Molecular Weight: | 164.158 |
| InChI: | InChI=1/C9H8O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.242 g/cm3 |
| Refractive index: | 1.556 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
