| Identification | |
| Name: | o-Tolylthiourea |
| Synonyms: | 1-(2-Methylphenyl)-2-thiourea; ortho-Tolylthiourea; (2-methylphenyl)thiourea |
| CAS: | 614-78-8 |
| EINECS: | 210-395-3 |
| Molecular Formula: | C8H10N2S |
| Molecular Weight: | 166.24 |
| InChI: | InChI=1/C8H10N2S/c1-6-4-2-3-5-7(6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 120.4°C |
| Boiling Point: | 295 |
| Density: | 1.242g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.696 |
| Solubility: | Slightly soluble |
| Appearance: | Crystalline solid. |
| Specification: |
When heated to decomposition, N-(2-Methylphenyl)thiourea emits very toxic fumes of oxides of nitrogen and sulfur. [EPA, 1998]. Organosulfides are incompatible with acids, diazo and azo compounds, halocarbons, isocyanates, aldehydes, alkali metals, nitrides, hydrides, and other strong reducing agents. Reactions with these materials generate heat and in many cases hydrogen gas. Many of these compounds may liberate hydrogen sulfide upon decomposition or reaction with an acid. |
| Report: |
EPA Extremely Hazardous Substances List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 120.4°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Needles (from dilute ethanol, water) |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
