| Identification | |
| Name: | N-(2-hydroxyphenyl)acetamide |
| CAS: | 614-80-2 |
| EINECS: | 210-396-9 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16256 |
| InChI: | InChI=1S/C8H9NO2/c1-6(10)9-7-4-2-3-5-8(7)11/h2-5,11H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 161.3°C |
| Boiling Point: | 343.1°C at 760 mmHg |
| Density: | 1.249g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, chloroformates, acids, acid chlorides, acid anhydrides. |
| Refractive index: | 1.618 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents,chloroformates, acids, acid chlorides, acid anhydrides. Toxicology Eye and skin irritant. Toxicity data |
| Solubility: |
|
| Appearance: | light brown powder |
| Specification: | light brown powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29242995 |
| Flash Point: | 161.3°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
