| Identification | |
| Name: | 5-Methylindole |
| Synonyms: | 1H-Indole, 5-methyl- (9CI);Indole, 5-methyl- (8CI);1H-Indole, 5-methyl-;Indole, 5-methyl-;5-methyl-1H-indole;5-Methylindol; |
| CAS: | 614-96-0 |
| EINECS: | 210-400-9 |
| Molecular Formula: | C9H9N |
| Molecular Weight: | 131.18 |
| InChI: | InChI=1/C9H9N/c1-7-2-3-9-8(6-7)4-5-10-9/h2-6,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100oC/3mm |
| Boiling Point: | 100oC/3mm |
| Density: | 1.11 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. Substance undergoes color change upon exposure to light and air. |
| Refractive index: | 1.5773 (78 C) |
| Solubility: | Insoluble |
| Appearance: | Solid. |
| Flash Point: | 100oC/3mm |
| Storage Temperature: | Keep Cold |
| Sensitive: | Light Sensitive |
| Usage: | Used as an intermediate in the synthesis of compounds with a variety of pharmacological properties. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
