| Identification | |
| Name: | Rolipram |
| Synonyms: | 2-Pyrrolidinone, 4-[3-(cyclopentyloxy)-4-methoxyphenyl]-;4-[3-(Cyclopentyloxy)-4-methoxyphenyl]-2-pyrrolidinone; |
| CAS: | 61413-54-5 |
| EINECS: | 262-771-1 |
| Molecular Formula: | C16H21NO3 |
| Molecular Weight: | 275.34284 |
| InChI: | InChI=1S/C16H21NO3/c1-19-14-7-6-11(12-9-16(18)17-10-12)8-15(14)20-13-4-2-3-5-13/h6-8,12-13H,2-5,9-10H2,1H3,(H,17,18) |
| Molecular Structure: | ![(C16H21NO3) 2-Pyrrolidinone, 4-[3-(cyclopentyloxy)-4-methoxyphenyl]-;4-[3-(Cyclopentyloxy)-4-methoxyphenyl]-2-py...](https://img.guidechem.com/casimg/61413-54-5.gif) |
| Properties | |
| Transport: | 3249 |
| Density: | 1.155 g/cm3 |
| Refractive index: | 1.552 |
| Water Solubility: | H2O: 0.2 mg/mL |
| Solubility: | H2O: 0.2 mg/mL |
| Appearance: | solid |
| Specification: | Yellowish solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Biological Activity: | Selective inhibitor of cAMP phosphodiesterase (PDE4) (IC 50 = 2.0 μ M). Discriminates between two conformational states of PDE4 isoenzymes. See separate isomers ((R)-(-)-Rolipram and (S)-(+)-Rolipram). |
| Storage Temperature: | 0-6°C |
| Color: | white to off-white |
| Safety Data | |
 |
|
