| Identification | |
| Name: | Butanoic acid,4-(methylnitrosoamino)- |
| Synonyms: | N-Methyl-N-(3-carboxypropyl)nitrosamine |
| CAS: | 61445-55-4 |
| Molecular Formula: | C5H10 N2 O3 |
| Molecular Weight: | 146.17 |
| InChI: | InChI=1/C5H10N2O3/c1-7(6-10)4-2-3-5(8)9/h2-4H2,1H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.9°C |
| Boiling Point: | 364°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.497 |
| Specification: | Yellow Oil usageEng:This N-nitrosamino acid has been isolated and identified in various types of tobacco, inlcluding snuff, chewing and pipe tobacco, cigars and cigarettes. The occurence of N-nitrosamino acids are highly correlated with levels of tobacco-specific N-nitrosamines which are known carcinogens in a wide range of animal species. |
| Flash Point: | 173.9°C |
| Usage: |
The occurence of N-nitrosamino acids are highly correlated with levels of tobacco-specific N-ni .This N-nitrosamino acid has been isolated and identified in various types of tobacco, inlcluding snuff, and so on. |
| Safety Data | |
 |
|
