| Identification | |
| Name: | 4-((4-Aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl)aniline mononitrate |
| Synonyms: | 4-[(4-aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline mononitrate |
| CAS: | 61467-64-9 |
| EINECS: | 262-806-0 |
| Molecular Formula: | C19H18N4O3 |
| Molecular Weight: | 349.36328 |
| InChI: | InChI=1/C19H17N3.HNO3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;2-1(3)4/h1-12,20H,21-22H2;(H,2,3,4) |
| Molecular Structure: | ![(C19H18N4O3) 4-[(4-aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline mononitrate](https://img.guidechem.com/cas/gif/61467-64-9.gif) |
| Properties | |
| Melting Point: | 268-270 deg C (decomposes) |
| Solubility: | SOL IN ALCOHOL; VERY SLIGHTLY SOL IN WATER & ETHER Soluble in water (2-3 mg/ml), ethanol (2-25 mg/ml) ethylene glycol methyl ether (50-70 mg/ml) and methanol |
| Color: | COLORLESS TO RED CRYSTALS Dark-green crystalline powder |
| Safety Data | |
 |
|
