| Identification |
| Name: | Benzothiazole,2-(methylthio)- |
| Synonyms: | 2-(Methylmercapto)benzothiazole;2-(Methylthio)benzothiazole;Methylcaptax;NSC 31259;NSC 41046;NSC 5352; |
| CAS: | 615-22-5 |
| EINECS: | 210-417-1 |
| Molecular Formula: | C8H7NS2 |
| Molecular Weight: | 181.27 |
| InChI: | InChI=1/C8H7NS2/c1-5-9-8-6(10)3-2-4-7(8)11-5/h2-4,10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 47-49 ºC |
| Flash Point: | >110 ºC |
| Density: | 1.31 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Reacts with water to form toxic fumes. |
| Refractive index: | 1.723 |
| Solubility: | Insoluble |
| Appearance: | white to light yellow waxy crystalline. |
| Flash Point: | >110 ºC |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Water free area. Keep away from acids. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
