| Identification | |
| Name: | 2-Bromoaniline |
| Synonyms: | o-bromoaniline; 2-bromo-benzenamin; Aniline, o-bromo-; Benzenamine,2-bromo-; o-Aminobromobenzene; o-Chloroaceto-N-acetanilide; 1-Amino-2-bromobenzene; AKOS BBS-00003650; BROMOANILINE(2-); 2-Bromoanilines; o-Bromoaniline 2-Bromoaniline; 2-BROMOANILINE 99%; 2-Bromoaniline,~98%; 2-BROMO ANILINE FOR SYNTHESIS; 2-Bromobenzeneamine; ORTHO-BROMOANILINE; 2-Bromo-phenylamine |
| CAS: | 615-36-1 |
| EINECS: | 210-421-3 |
| Molecular Formula: | C6H6BrN |
| Molecular Weight: | 172.02254 |
| InChI: | InChI=1S/C6H6BrN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 281 |
| Flash Point: | 110 C |
| Density: | 1.57 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.617-1.619 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear to yellow liquid (or solid) |
| Specification: | CLEAR YELLOW TO RED-BROWN LIQUID AFTER MELTING Safety Statements:36/37-45-61-36/37/39-26 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Flash Point: | 110 C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
