| Identification | |
| Name: | 2,4-Dibromophenol |
| Synonyms: | 2,4-Dibromophenol;NSC 5723; NSC 6213 |
| CAS: | 615-58-7 |
| EINECS: | 210-436-5 |
| Molecular Formula: | C6H4Br2O |
| Molecular Weight: | 251.9 |
| InChI: | InChI=1/C6H4Br2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 2.095 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.643 |
| Solubility: | Insoluble |
| Appearance: | White or light yellow solid to liquid |
| Specification: |
2,4-Dibromophenol (615-58-7) is a white crystalline powder and stable at room temperature in closed containers under normal storage and handling conditions. It should store in a tightly closed container with a cool, dry, well-ventilated area away from incompatible substances. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Poison room locked. |
| Color: | Needles from petroleum ether |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
