| Identification |
| Name: | Benzene,1,4-dibromo-2-methyl- |
| Synonyms: | Toluene,2,5-dibromo- (6CI,7CI,8CI);1,4-Dibromo-2-methylbenzene;1,4-Dibromotoluene;3,6-Dibromotoluene;NSC 6222; |
| CAS: | 615-59-8 |
| EINECS: | 210-437-0 |
| Molecular Formula: | C7H6Br2 |
| Molecular Weight: | 249.93 |
| InChI: | InChI=1/C7H6Br2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.815 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.601-1.603 |
| Solubility: | Insoluble |
| Appearance: | colorless to light yellow clear liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
