| Identification | |
| Name: | Benzene,4-chloro-1,2-dimethyl- |
| Synonyms: | o-Xylene,4-chloro- (8CI); 1,2-Dimethyl-4-chlorobenzene; 1-Chloro-3,4-dimethylbenzene;3,4-Dimethylchlorobenzene; 3,4-Dimethylphenyl chloride;4-Chloro-1,2-dimethylbenzene; 4-Chloro-o-xylene; p-Chloro-o-xylene |
| CAS: | 615-60-1 |
| EINECS: | 210-438-6 |
| Molecular Formula: | C8H9 Cl |
| Molecular Weight: | 140.61 |
| InChI: | InChI=1/C8H9Cl/c1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.047 |
| Refractive index: | 1.5273-1.5293 |
| Appearance: | Clear colourless to light yellow liquid |
| Specification: |
4-Chloro-1,2-dimethylbenzene (CAS NO.615-60-1), its Synonyms are 4-Chloro-o-xylene ; Benzene, 4-chloro-1,2-dimethyl- ; o-Xylene, 4-chloro- ; 1-Chloro-3,4-dimethylbenzene ; 1-Chloro-3,4-dimethylbenzene 98% . It is clear colourless to light yellow liquid. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
