| Identification | |
| Name: | 2-Chloro-5-methylphenol |
| Synonyms: | 4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
| CAS: | 615-74-7 |
| EINECS: | 210-444-9 |
| Molecular Formula: | C7H7ClO |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3437 6.1/PG 2 |
| Density: | 1.215 |
| Solubility: | Very soluble in ethanol Greater than 1.00 mg/l in water |
| Specification: | BEIGE CRYSTALLINE POWDER Safety Statements:26-36/37/39-28 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29081000 |
| Color: | Prisms from petroleum ether |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
