| Identification | |
| Name: | (R)-1-Phenylbutylamine, |
| Synonyms: | Benzylamine,a-propyl-, (+)- (8CI);(+)-1-Phenylbutylamine |
| CAS: | 6150-01-2 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-2-6-10(11)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6,11H2,1H3/t10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2735 |
| Density: | 0.934g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
The (R)-1-Phenylbutylamine with cas registry number of 6150-01-2, has the systematic name of (1R)-1-phenylbutan-1-amine. And it is also named benzenemethanamine, alpha-propyl-, (alphaR)-. Physical properties about this chemical are: (1)ACD/LogP: 2.50; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 1; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 3.24 Å2; (7)Index of Refraction: 1.52; (8)Molar Refractivity: 48.6 cm3; (9)Molar Volume: 159.6 cm3; (10)Polarizability: 19.26×10-24cm3; (11)Surface Tension: 35.9 dyne/cm; (12)Enthalpy of Vaporization: 46.04 kJ/mol; (13)Vapour Pressure: 0.0938 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Packinggroup: | III |
| Safety Data | |
 |
|
