| Identification | |
| Name: | 1,3-Benzenediol,5-methyl-, hydrate (1:1) |
| Synonyms: | 1,3-Benzenediol,5-methyl-, monohydrate (9CI);Resorcinol, 5-methyl-, monohydrate (8CI);Orcinolmonohydrate; |
| CAS: | 6153-39-5 |
| EINECS: | 207-984-2 |
| Molecular Formula: | C7H10O3 |
| Molecular Weight: | 142.15 |
| InChI: | InChI=1/C7H8O2.H2O/c1-5-2-6(8)4-7(9)3-5;/h2-4,8-9H,1H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. May be air-sensitive. |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water |
| Appearance: | White to beige crystalline powder |
| Specification: |
1,3-Benzenediol,5-methyl-, hydrate (1:1) (CAS NO.6153-39-5) is also called as 5-Methylresorcinol monohydrate ; Resorcinol, 5-methyl-, monohydrate . It is a white to beige crystalline powder. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
