| Identification | |
| Name: | Oxalic acid dihydrate |
| Synonyms: | oxalic acid free acid dihydrate; Ethanedioic acid, dihydrate |
| CAS: | 6153-56-6 |
| EINECS: | 205-634-3 |
| Molecular Formula: | C2H2O4?2(H2O) |
| Molecular Weight: | 126.06 |
| InChI: | InChI=1/C2H2O4.2H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Density: | 1.65 |
| Stability: | Stable. Incompatible with bases, acid chlorides, steel, silver, silver compounds, moisture. Avoid contact with metals. |
| Appearance: | white crystals |
| Specification: |
?Ethanedioic acid, dihydrate , its cas register number is 6153-56-6. It also can be called?Dicarbolic acid dihydrate ; Ethanedioic acid dihydrate .It is a?white crystals. |
| Packinggroup: | III |
| HS Code: | 29171100 |
| Storage Temperature: | Store at RT. |
| Usage: | Wood bleaching and brightener, stain remover. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
