| Identification | |
| Name: | 8-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride |
| Synonyms: | 8-Chloro-1,2,3,4-tetrahydro-isoquinoline hydrochloride; |
| CAS: | 61563-33-5 |
| Molecular Formula: | C9H102N.HCl |
| Molecular Weight: | 261.38 |
| InChI: | InChI=1/C9H10ClN.ClH/c10-9-3-1-2-7-4-5-11-6-8(7)9;/h1-3,11H,4-6H2;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 8-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride, with the CAS registry number 61563-33-5, is also known as Isoquinoline, 8-chloro-1,2,3,4-tetrahydro-, hydrochloride. This chemical's molecular formula is C9H11Cl2N and molecular weight is 261.38. What's more, its systematic name is called 8-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Physical properties about 8-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride are: (1) ACD/LogP: 2.00; (2) # of Rule of 5 Violations: 0; (3) ACD/LogD (pH 7.4): 0.64; (4) ACD/BCF (pH 5.5): 1; (5) ACD/BCF (pH 7.4): 1; (6) ACD/KOC (pH 5.5): 1; (7) ACD/KOC (pH 7.4): 12.65; (8) #H bond acceptors: 1; (9) #H bond donors: 1; (10) #Freely Rotating Bonds: 0; (11) Polar Surface Area: 12.03 Å2; (12) Flash Point: 141.4 °C; (13) Enthalpy of Vaporization: 56.19 kJ/mol; (14) Boiling Point: 310.1 °C at 760 mmHg; (15) Vapour Pressure: 0.000452 mmHg at 25 °C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
