Synonyms: | Propanoicacid, 2-hydroxy-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-[1a(S*),2b,5a]]-;2S-(1R,2S,5R)-Menthyl lactate;l-Menthyl L-Lactate; |
Specification: |
The CAS register number of L-Menthyl lactate is 61597-98-6. It also can be called as Propanoic acid,2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2S)- and the systematic name about this chemical is (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl (2S)-2-hydroxypropanoate. The molecular formula about this chemical is C13H24O3 and the molecular weight is 228.33. It belongs to the following product categories, such as Alphabetical Listings; Flavors and Fragrances; M-N and so on.
Physical properties about L-Menthyl lactate are: (1)ACD/LogP: 3.20; (2)ACD/LogD (pH 5.5): 3.2; (3)ACD/LogD (pH 7.4): 3.2; (4)ACD/BCF (pH 5.5): 160.23; (5)ACD/BCF (pH 7.4): 160.23; (6)ACD/KOC (pH 5.5): 1317.53; (7)ACD/KOC (pH 7.4): 1317.53; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 5; (11)Polar Surface Area: 35.53Å2; (12)Index of Refraction: 1.467; (13)Molar Refractivity: 63.47 cm3; (14)Molar Volume: 228.4 cm3; (15)Polarizability: 25.16x10-24cm3; (16)Surface Tension: 34.4 dyne/cm; (17)Enthalpy of Vaporization: 63.13 kJ/mol; (18)Boiling Point: 304 °C at 760 mmHg; (19)Vapour Pressure: 8.58E-05 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O[C@H]1[C@@H](CC[C@H](C1)C)C(C)C)[C@@H](O)C
(2)InChI: InChI=1/C13H24O3/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-12,14H,5-7H2,1-4H3/t9-,10+,11+,12-/m1/s1
(3)InChIKey: UJNOLBSYLSYIBM-NOOOWODRBN
(4)Std. InChI: InChI=1S/C13H24O3/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-12,14H,5-7H2,1-4H3/t9-,10+,11+,12-/m1/s1
(5)Std. InChIKey: UJNOLBSYLSYIBM-NOOOWODRSA-N
|