| Identification | |
| Name: | Citraconic anhydride |
| Synonyms: | Methylmaleic anhydride; 3-Methyl-2,5-pentanedione; CTA |
| CAS: | 616-02-4 |
| EINECS: | 210-459-0 |
| Molecular Formula: | C5H4O3 |
| Molecular Weight: | 112.08 |
| InChI: | InChI=1/C5H4O3/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.245 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.47-1.472 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
Citraconic anhydride (616-02-4) is crystallization. |
| Packinggroup: | III |
| HS Code: | 29171990 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Color: | COLORLESS LIQUID |
| Usage: | Reagent for alkalies, alcohols, and amines. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
