| Identification |
| Name: | Propanoic acid,2-hydroxy-, propyl ester |
| Synonyms: | Lacticacid, propyl ester (6CI,8CI);Propyl 2-hydroxypropanoate;Propyl lactate;n-Propyllactate; |
| CAS: | 616-09-1 |
| EINECS: | 210-464-8 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.15768 |
| InChI: | InChI=1S/C6H12O3/c1-3-4-9-6(8)5(2)7/h5,7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 3 |
| Flash Point: | 62.7 oC |
| Boiling Point: | 174.2 oCat 760 mmHg |
| Stability: | Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.411(lit.) |
| Water Solubility: | Stability Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicological abbreviations w |
| Solubility: | |
| Flash Point: | 62.7 oC |
| Safety Data |
| |
 |
