| Identification | |
| Name: | 1-Propanol,2,3-dichloro- |
| CAS: | 616-23-9 |
| EINECS: | 210-470-0 |
| Molecular Formula: | C3H6 Cl2 O |
| Molecular Weight: | 128.98514 |
| InChI: | InChI=1S/C3H6Cl2O/c4-1-3(5)2-6/h3,6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.36 |
| Refractive index: | 1.4835-1.4855 |
| Water Solubility: | soluble in water |
| Solubility: | soluble in water |
| Appearance: | clear, colorless liquid |
| Specification: |
2,3-Dichloropropanol (CAS NO.616-23-9) is a viscous colorless to amber liquid with an ethereal odor.It may be sensitive to prolonged exposure to air and slightly soluble in water.It is incompatible with oxidizers, oxygen and peroxides.And it is combustible. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | VISCOUS LIQ |
| Usage: | An isomer of dichloropropanol; shows metabolite toxicity. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
