| Identification | |
| Name: | 1-Penten-3-ol |
| Synonyms: | 1-Ethylallylalcohol;3-Hydroxy-1-pentene;Ethyl vinyl carbinol;NSC 65446;a-Ethylallyl alcohol; |
| CAS: | 616-25-1 |
| EINECS: | 210-472-1 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-3-5(6)4-2/h3,5-6H,1,4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Density: | 0.839 |
| Stability: | Stable. Flammable - note flashpoint is close to room temperature. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.422-1.426 |
| Water Solubility: | slightly soluble |
| Solubility: |
|
| Appearance: | clear colorless liquid |
| Specification: |
The extinguishing agent of 1-Penten-3-ol (CAS No. 616-25-1) are dry powder, foam, sand, carbon dioxide, water mist. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
